EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N2O3 |
| Net Charge | +1 |
| Average Mass | 367.469 |
| Monoisotopic Mass | 367.20162 |
| SMILES | CCNc1cc2oc3c/c(=[NH+]/CC)c(C)cc-3c(CCC(=O)O)c2cc1C |
| InChI | InChI=1S/C22H26N2O3/c1-5-23-18-11-20-16(9-13(18)3)15(7-8-22(25)26)17-10-14(4)19(24-6-2)12-21(17)27-20/h9-12,23H,5-8H2,1-4H3,(H,25,26)/p+1/b24-19- |
| InChIKey | PUXJFVSSOFFDHC-CLCOLTQESA-O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATTO 520-2(1+) (CHEBI:52795) has role fluorochrome (CHEBI:51217) |
| ATTO 520-2(1+) (CHEBI:52795) is a monocarboxylic acid (CHEBI:25384) |
| ATTO 520-2(1+) (CHEBI:52795) is a xanthene dye (CHEBI:37929) |
| Incoming Relation(s) |
| ATTO 520-2 (CHEBI:51812) has part ATTO 520-2(1+) (CHEBI:52795) |
| IUPAC Name |
|---|
| N-[9-(2-carboxyethyl)-6-(ethylamino)-2,7-dimethyl-3H-xanthen-3-ylidene]ethanaminium |