EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N3O2 |
| Net Charge | +1 |
| Average Mass | 296.350 |
| Monoisotopic Mass | 296.13935 |
| SMILES | Nc1ccc2cc3ccc(N)cc3[n+](CCCC(=O)O)c2c1 |
| InChI | InChI=1S/C17H17N3O2/c18-13-5-3-11-8-12-4-6-14(19)10-16(12)20(15(11)9-13)7-1-2-17(21)22/h3-6,8-10H,1-2,7H2,(H4,18,19,21,22)/p+1 |
| InChIKey | QPFZFJUTVZNUOZ-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATTO 465-2(1+) (CHEBI:52792) has role fluorochrome (CHEBI:51217) |
| ATTO 465-2(1+) (CHEBI:52792) is a acridinium ion (CHEBI:52839) |
| ATTO 465-2(1+) (CHEBI:52792) is a aminoacridines (CHEBI:51803) |
| ATTO 465-2(1+) (CHEBI:52792) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| ATTO 465-2 (CHEBI:51787) has part ATTO 465-2(1+) (CHEBI:52792) |
| IUPAC Name |
|---|
| 3,6-diamino-10-(3-carboxypropyl)acridinium |