EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2oc3c(O)ccc(O)c3c(=O)c2c1O |
| InChI | InChI=1S/C23H24O6/c1-11(2)5-7-13-19(26)14(8-6-12(3)4)22-18(20(13)27)21(28)17-15(24)9-10-16(25)23(17)29-22/h5-6,9-10,24-27H,7-8H2,1-4H3 |
| InChIKey | OJXQLGQIDIPMTE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia mangostana (ncbitaxon:58228) | - | PubMed (18464091) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gartanin (CHEBI:5279) has role antineoplastic agent (CHEBI:35610) |
| gartanin (CHEBI:5279) has role plant metabolite (CHEBI:76924) |
| gartanin (CHEBI:5279) is a polyphenol (CHEBI:26195) |
| gartanin (CHEBI:5279) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,3,5,8-tetrahydroxy-2,4-bis(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,3,5,8-Tetrahydroxy-2,4-diprenylxanthone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C10063 | KEGG COMPOUND |
| C00002951 | KNApSAcK |
| CN101869559 | Patent |
| HMDB0030700 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1357259 | Reaxys |
| CAS:33390-42-0 | KEGG COMPOUND |
| Citations |
|---|