EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23N2S2 |
| Net Charge | +1 |
| Average Mass | 391.585 |
| Monoisotopic Mass | 391.12972 |
| SMILES | [H]C(=C([H])C([H])=C1Sc2ccccc2N1CC)C([H])=C([H])c1sc2ccccc2[n+]1CC |
| InChI | InChI=1S/C23H23N2S2/c1-3-24-18-12-8-10-14-20(18)26-22(24)16-6-5-7-17-23-25(4-2)19-13-9-11-15-21(19)27-23/h5-17H,3-4H2,1-2H3/q+1 |
| InChIKey | FYXWDSGGZAMYFZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dithiazanine (CHEBI:52787) has role anthelminthic drug (CHEBI:35443) |
| dithiazanine (CHEBI:52787) has role fluorochrome (CHEBI:51217) |
| dithiazanine (CHEBI:52787) is a benzothiazoles (CHEBI:37947) |
| dithiazanine (CHEBI:52787) is a benzothiazolium ion (CHEBI:52838) |
| Incoming Relation(s) |
| dithiazanine iodide (CHEBI:228275) has part dithiazanine (CHEBI:52787) |
| IUPAC Name |
|---|
| 3-ethyl-2-[5-(3-ethyl-1,3-benzothiazol-2(3H)-ylidene)penta-1,3-dien-1-yl]-1,3-benzothiazol-3-ium |
| Synonyms | Source |
|---|---|
| 3,3'-diethylthiadicarbocyanine | ChEBI |
| Dithiazanine | ChemIDplus |
| Dithiazaninum | ChemIDplus |