EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O11 |
| Net Charge | 0 |
| Average Mass | 404.368 |
| Monoisotopic Mass | 404.13186 |
| SMILES | [H][C@@]12[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C(C(=O)OC)[C@]1([H])C=C[C@]2(O)CO |
| InChI | InChI=1S/C17H24O11/c1-25-14(23)8-5-26-15(10-7(8)2-3-17(10,24)6-19)28-16-13(22)12(21)11(20)9(4-18)27-16/h2-3,5,7,9-13,15-16,18-22,24H,4,6H2,1H3/t7-,9+,10-,11+,12-,13+,15+,16-,17-/m0/s1 |
| InChIKey | XJMPAUZQVRGFRE-HPWCAOHFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gardenoside (CHEBI:5277) has functional parent 7-deoxyloganin (CHEBI:18370) |
| gardenoside (CHEBI:5277) has role metabolite (CHEBI:25212) |
| gardenoside (CHEBI:5277) is a cyclopentapyran (CHEBI:38606) |
| gardenoside (CHEBI:5277) is a enoate ester (CHEBI:51702) |
| gardenoside (CHEBI:5277) is a methyl ester (CHEBI:25248) |
| gardenoside (CHEBI:5277) is a monosaccharide derivative (CHEBI:63367) |
| gardenoside (CHEBI:5277) is a tertiary alcohol (CHEBI:26878) |
| gardenoside (CHEBI:5277) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| methyl (1R,4aR,7R,7aR)-1-(β-D-glucopyranosyloxy)-7-hydroxy-7-(hydroxymethyl)-1,4a,7,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| Registry Numbers | Sources |
|---|---|
| CAS:24512-62-7 | KEGG COMPOUND |
| CAS:24512-62-7 | ChemIDplus |