EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H15N2O5 |
| Net Charge | +1 |
| Average Mass | 375.360 |
| Monoisotopic Mass | 375.09755 |
| SMILES | Nc1ccc2c(-c3cc(C(=O)O)ccc3C(=O)O)c3ccc(=[NH2+])cc-3oc2c1 |
| InChI | InChI=1S/C21H14N2O5/c22-11-2-5-14-17(8-11)28-18-9-12(23)3-6-15(18)19(14)16-7-10(20(24)25)1-4-13(16)21(26)27/h1-9,22H,23H2,(H,24,25)(H,26,27)/p+1 |
| InChIKey | QQEYEWAWPJNTTJ-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhodamine green 6-isomer (CHEBI:52766) has role fluorochrome (CHEBI:51217) |
| rhodamine green 6-isomer (CHEBI:52766) is a rhodamine green (CHEBI:52764) |
| IUPAC Name |
|---|
| 6-amino-9-(2,5-dicarboxyphenyl)-3H-xanthen-3-iminium |