EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H43NO6 |
| Net Charge | 0 |
| Average Mass | 585.741 |
| Monoisotopic Mass | 585.30904 |
| SMILES | CCCCCCCCCCCCCCCC(=O)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C36H43NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-34(40)37-25-16-19-28(31(22-25)36(41)42)35-29-20-17-26(38)23-32(29)43-33-24-27(39)18-21-30(33)35/h16-24,38H,2-15H2,1H3,(H,37,40)(H,41,42) |
| InChIKey | NIOAQWNBYGPMHJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(N-hexadecanoyl)aminofluorescin (CHEBI:52745) has functional parent fluorescin (CHEBI:42492) |
| 5-(N-hexadecanoyl)aminofluorescin (CHEBI:52745) has role fluorochrome (CHEBI:51217) |
| 5-(N-hexadecanoyl)aminofluorescin (CHEBI:52745) is a amidobenzoic acid (CHEBI:48470) |
| 5-(N-hexadecanoyl)aminofluorescin (CHEBI:52745) is a xanthene dye (CHEBI:37929) |
| IUPAC Name |
|---|
| 5-(hexadecanoylamino)-2-(6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid |
| Synonym | Source |
|---|---|
| haf | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6551409 | Beilstein |