EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25BN4O4 |
| Net Charge | 0 |
| Average Mass | 384.245 |
| Monoisotopic Mass | 384.19689 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1cnccn1)B(O)O |
| InChI | InChI=1S/C19H25BN4O4/c1-13(2)10-17(20(27)28)24-18(25)15(11-14-6-4-3-5-7-14)23-19(26)16-12-21-8-9-22-16/h3-9,12-13,15,17,27-28H,10-11H2,1-2H3,(H,23,26)(H,24,25)/t15-,17-/m0/s1 |
| InChIKey | GXJABQQUPOEUTA-RDJZCZTQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bortezomib (CHEBI:52717) has functional parent boronic acid (CHEBI:38267) |
| bortezomib (CHEBI:52717) has role antineoplastic agent (CHEBI:35610) |
| bortezomib (CHEBI:52717) has role antiprotozoal drug (CHEBI:35820) |
| bortezomib (CHEBI:52717) has role protease inhibitor (CHEBI:37670) |
| bortezomib (CHEBI:52717) has role proteasome inhibitor (CHEBI:52726) |
| bortezomib (CHEBI:52717) is a L-phenylalanine derivative (CHEBI:84144) |
| bortezomib (CHEBI:52717) is a amino acid amide (CHEBI:22475) |
| bortezomib (CHEBI:52717) is a pyrazines (CHEBI:38314) |
| IUPAC Names |
|---|
| N-[(1R)-1-(dihydroxyboranyl)-3-methylbutyl]-Nα-(pyrazin-2-ylcarbonyl)-L-phenylalaninamide |
| [(1R)-3-methyl-1-({(2S)-3-phenyl-2-[(pyrazin-2-ylcarbonyl)amino]propanoyl}amino)butyl]boronic acid |
| INN | Source |
|---|---|
| bortezomib | ChemIDplus |
| Synonyms | Source |
|---|---|
| N-[(1R)-1-(DIHYDROXYBORYL)-3-METHYLBUTYL]-N-(PYRAZIN-2-YLCARBONYL)-L-PHENYLALANINAMIDE | PDBeChem |
| PS-341 | ChemIDplus |
| PS 341 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Velcade | DrugBank |
| UniProt Name | Source |
|---|---|
| bortezomib | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8723817 | Reaxys |
| CAS:179324-69-7 | ChemIDplus |
| Citations |
|---|