EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H40ClN3O4 |
| Net Charge | 0 |
| Average Mass | 686.252 |
| Monoisotopic Mass | 685.27073 |
| SMILES | CC1=CC(C)(C)N(C)c2cc3c(cc21)C(c1cc(NC(=O)c2ccc(CCl)cc2)ccc1C(=O)[O-])=c1cc2c(cc1O3)=[N+](C)C(C)(C)C=C2C |
| InChI | InChI=1S/C42H40ClN3O4/c1-23-20-41(3,4)45(7)34-18-36-32(16-29(23)34)38(33-17-30-24(2)21-42(5,6)46(8)35(30)19-37(33)50-36)31-15-27(13-14-28(31)40(48)49)44-39(47)26-11-9-25(22-43)10-12-26/h9-21H,22H2,1-8H3,(H-,44,47,48,49) |
| InChIKey | BFKXVYPQJDQWTE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CellTracker red CMTPX 6-isomer (CHEBI:52716) has role fluorochrome (CHEBI:51217) |
| CellTracker red CMTPX 6-isomer (CHEBI:52716) is a CellTracker red CMTPX (CHEBI:52711) |
| IUPAC Name |
|---|
| 4-({[4-(chloromethyl)phenyl]carbonyl}amino)-2-(1,2,2,4,8,10,10,11-octamethyl-10,11-dihydro-2H-pyrano[3,2-g:5,6-g']diquinolin-1-ium-6-yl)benzoate |