EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O11 |
| Net Charge | 0 |
| Average Mass | 562.527 |
| Monoisotopic Mass | 562.14751 |
| SMILES | Oc1ccc([C@H]2Oc3cc(O)cc(O)c3[C@H](c3c(O)cc(O)c4c3O[C@H](c3ccc(O)c(O)c3)[C@@H](O)C4)[C@H]2O)cc1 |
| InChI | InChI=1S/C30H26O11/c31-14-4-1-12(2-5-14)29-27(39)26(24-20(36)8-15(32)9-23(24)40-29)25-21(37)11-18(34)16-10-22(38)28(41-30(16)25)13-3-6-17(33)19(35)7-13/h1-9,11,22,26-29,31-39H,10H2/t22-,26+,27+,28+,29+/m0/s1 |
| InChIKey | KUODBSWFMJMVJV-UKWJTHFESA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gambiriin C (CHEBI:5271) is a proanthocyanidin (CHEBI:26267) |
| Synonyms | Source |
|---|---|
| Epiafzelechin-(4beta->8)-catechin | KEGG COMPOUND |
| Gambiriin C | KEGG COMPOUND |