EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5IO4 |
| Net Charge | 0 |
| Average Mass | 280.017 |
| Monoisotopic Mass | 279.92326 |
| SMILES | O=C(O)c1ccccc1I(=O)=O |
| InChI | InChI=1S/C7H5IO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10) |
| InChIKey | FIYYMXYOBLWYQO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ortho-iodylbenzoic acid (CHEBI:52700) is a benzoic acids (CHEBI:22723) |
| ortho-iodylbenzoic acid (CHEBI:52700) is a organoiodine compound (CHEBI:37142) |
| ortho-iodylbenzoic acid (CHEBI:52700) is tautomer of 1-hydroxy-1,3-dioxobenziodoxole (CHEBI:52701) |
| Incoming Relation(s) |
| 1-hydroxy-1,3-dioxobenziodoxole (CHEBI:52701) is tautomer of ortho-iodylbenzoic acid (CHEBI:52700) |
| IUPAC Name |
|---|
| 2-iodylbenzoic acid |
| Synonyms | Source |
|---|---|
| 2-iodoxybenzoic acid | ChemIDplus |
| 2-iodylbenzoic acid | SUBMITTER |
| acide 2-iodoxybenzoïque | ChEBI |
| ácido 2-yodoxibenzoico | ChEBI |
| o-Iodoxybenzoesäure | ChEBI |
| o-iodoxybenzoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2445017 | Beilstein |
| CAS:64297-64-9 | ChemIDplus |
| Citations |
|---|