EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O14 |
| Net Charge | 0 |
| Average Mass | 610.524 |
| Monoisotopic Mass | 610.13226 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1cc(O)c(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C30H26O14/c31-11-5-14(33)22-21(6-11)43-29(10-3-18(37)26(41)19(38)4-10)27(42)24(22)23-15(34)8-13(32)12-7-20(39)28(44-30(12)23)9-1-16(35)25(40)17(36)2-9/h1-6,8,20,24,27-29,31-42H,7H2/t20-,24+,27+,28-,29-/m1/s1 |
| InChIKey | RTEDIEITOBJPNI-MMKMIGCXSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gallocatechin-(4alpha->8)-epigallocatechin (CHEBI:5270) is a proanthocyanidin (CHEBI:26267) |
| Synonym | Source |
|---|---|
| Gallocatechin-(4alpha->8)-epigallocatechin | KEGG COMPOUND |