EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5IO3 |
| Net Charge | 0 |
| Average Mass | 264.018 |
| Monoisotopic Mass | 263.92834 |
| SMILES | O=Ic1ccccc1C(=O)O |
| InChI | InChI=1S/C7H5IO3/c9-7(10)5-3-1-2-4-6(5)8-11/h1-4H,(H,9,10) |
| InChIKey | IFPHDUVGLXEIOQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor An EC 4.3.1.* (ammonia-lyase) inhibitor that interferes with the action of diaminopropionate ammonia-lyase (EC 4.3.1.15). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ortho-iodosylbenzoic acid (CHEBI:52698) has role EC 4.3.1.15 (diaminopropionate ammonia-lyase) inhibitor (CHEBI:77881) |
| ortho-iodosylbenzoic acid (CHEBI:52698) is a benzoic acids (CHEBI:22723) |
| ortho-iodosylbenzoic acid (CHEBI:52698) is a organoiodine compound (CHEBI:37142) |
| ortho-iodosylbenzoic acid (CHEBI:52698) is tautomer of 1-hydroxy-3-oxobenziodoxole (CHEBI:52699) |
| Incoming Relation(s) |
| 1-hydroxy-3-oxobenziodoxole (CHEBI:52699) is tautomer of ortho-iodosylbenzoic acid (CHEBI:52698) |
| IUPAC Name |
|---|
| 2-iodosylbenzoic acid |
| Synonyms | Source |
|---|---|
| o-iodosylbenzoic acid | SUBMITTER |
| 2-Iodosobenzoic acid | ChemIDplus |
| 2-Iodosylbenzoic acid | ChemIDplus |
| o-Iodosobenzoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1939973 | Beilstein |
| CAS:304-91-6 | ChemIDplus |
| Citations |
|---|