EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14NO9P |
| Net Charge | 0 |
| Average Mass | 287.161 |
| Monoisotopic Mass | 287.04062 |
| SMILES | NC(CC(O)C(O)C(=O)COP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C7H14NO9P/c8-3(7(12)13)1-4(9)6(11)5(10)2-17-18(14,15)16/h3-4,6,9,11H,1-2,8H2,(H,12,13)(H2,14,15,16) |
| InChIKey | OABFYXXSGQYCAM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4,5-dihydroxy-6-oxo-7-(phosphonooxy)heptanoic acid (CHEBI:52669) has functional parent heptanoic acid (CHEBI:45571) |
| 2-amino-4,5-dihydroxy-6-oxo-7-(phosphonooxy)heptanoic acid (CHEBI:52669) is a monoalkyl phosphate (CHEBI:25381) |
| 2-amino-4,5-dihydroxy-6-oxo-7-(phosphonooxy)heptanoic acid (CHEBI:52669) is a oxo monocarboxylic acid (CHEBI:35871) |
| 2-amino-4,5-dihydroxy-6-oxo-7-(phosphonooxy)heptanoic acid (CHEBI:52669) is conjugate acid of 2-azaniumyl-4,5-dihydroxy-6-oxo-7-(phosphonatooxy)heptanoate(2−) (CHEBI:58898) |
| Incoming Relation(s) |
| 2-azaniumyl-4,5-dihydroxy-6-oxo-7-(phosphonatooxy)heptanoate(2−) (CHEBI:58898) is conjugate base of 2-amino-4,5-dihydroxy-6-oxo-7-(phosphonooxy)heptanoic acid (CHEBI:52669) |
| IUPAC Name |
|---|
| 2-amino-4,5-dihydroxy-6-oxo-7-(phosphonooxy)heptanoic acid |