EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H46O6 |
| Net Charge | 0 |
| Average Mass | 526.714 |
| Monoisotopic Mass | 526.32944 |
| SMILES | CC(/C=C/C[C@@H](C)/C=C(C)/C=C/[C@@H]1OC(=O)C=C[C@@H]1C)=C\[C@@H](C)C(=O)[C@@H](C)[C@H](O)[C@@H](C)C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C32H46O6/c1-20(16-22(3)12-14-28-24(5)13-15-30(35)38-28)10-9-11-21(2)17-25(6)31(36)27(8)32(37)26(7)18-23(4)19-29(33)34/h9,11-17,19-20,24-28,32,37H,10,18H2,1-8H3,(H,33,34)/b11-9+,14-12+,21-17+,22-16+,23-19+/t20-,24+,25-,26+,27-,28+,32-/m1/s1 |
| InChIKey | QECBVZBMGUAZDL-JSADDXMJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leptomycin A (CHEBI:52650) has functional parent tetracosanoic acid (CHEBI:28866) |
| leptomycin A (CHEBI:52650) has role antifungal agent (CHEBI:35718) |
| leptomycin A (CHEBI:52650) has role bacterial metabolite (CHEBI:76969) |
| leptomycin A (CHEBI:52650) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| leptomycin A (CHEBI:52650) is a leptomycin (CHEBI:52651) |
| IUPAC Name |
|---|
| (2E,5S,6R,7S,9R,10E,12E,15R,16E,18E)-6-hydroxy-3,5,7,9,11,15,17-heptamethyl-19-[(2S,3S)-3-methyl-6-oxo-3,6-dihydro-2H-pyran-2-yl]-8-oxononadeca-2,10,12,16,18-pentaenoic acid |
| Synonyms | Source |
|---|---|
| (2E,10E,12E,16Z,18E)-(R)-6-hydroxy-3,5,7,9,11,15,17-heptamethyl-19-((2S,3S)-3-methyl-6-oxo-3,6-dihydro-2H-pyran-2-yl)-8-oxo-nonadeca-2,10,12,16,18-pentaenoic acid | ChEBI |
| Antibiotic ATS 1287A | ChEBI |
| Antibiotic PD 118607 | ChEBI |
| Jildamycin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13029203 | Reaxys |
| CAS:87081-36-5 | ChemIDplus |
| Citations |
|---|