EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H48O6 |
| Net Charge | 0 |
| Average Mass | 540.741 |
| Monoisotopic Mass | 540.34509 |
| SMILES | CCC(=C/[C@H](C)C/C=C/C(C)=C/[C@@H](C)C(=O)[C@@H](C)[C@H](O)[C@@H](C)C/C(C)=C/C(=O)O)/C=C/[C@@H]1OC(=O)C=C[C@@H]1C |
| InChI | InChI=1S/C33H48O6/c1-9-28(14-15-29-24(5)13-16-31(36)39-29)19-22(3)12-10-11-21(2)17-25(6)32(37)27(8)33(38)26(7)18-23(4)20-30(34)35/h10-11,13-17,19-20,22,24-27,29,33,38H,9,12,18H2,1-8H3,(H,34,35)/b11-10+,15-14+,21-17+,23-20+,28-19-/t22-,24+,25-,26+,27-,29+,33-/m1/s1 |
| InChIKey | YACHGFWEQXFSBS-XYERBDPFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leptomycin B (CHEBI:52646) has functional parent tetracosanoic acid (CHEBI:28866) |
| leptomycin B (CHEBI:52646) has role antifungal agent (CHEBI:35718) |
| leptomycin B (CHEBI:52646) has role bacterial metabolite (CHEBI:76969) |
| leptomycin B (CHEBI:52646) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| leptomycin B (CHEBI:52646) is a leptomycin (CHEBI:52651) |
| IUPAC Name |
|---|
| (2E,5S,6R,7S,9R,10E,12E,15R,16Z,18E)-17-ethyl-6-hydroxy-3,5,7,9,11,15-hexamethyl-19-[(2S,3S)-3-methyl-6-oxo-3,6-dihydro-2H-pyran-2-yl]-8-oxononadeca-2,10,12,16,18-pentaenoic acid |
| Synonyms | Source |
|---|---|
| antibiotic ATS 1287B | ChEBI |
| Antibiotic CI 940 | ChemIDplus |
| Antibiotic CL 1957A | ChemIDplus |
| Antibiotic PD 114720 | ChEBI |
| ATS 1287B | ChEBI |
| LMB | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7958583 | Beilstein |
| Reaxys:8299374 | Reaxys |
| CAS:87081-35-4 | ChemIDplus |
| Citations |
|---|