EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N4 |
| Net Charge | 0 |
| Average Mass | 314.392 |
| Monoisotopic Mass | 314.15315 |
| SMILES | C1=Cc2cc3ccc(cc4nc(cc5nc(cc1n2)CC5)CC4)n3 |
| InChI | InChI=1S/C20H18N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-4,9-12,21,24H,5-8H2/b15-9-,16-10-,19-11-,20-12- |
| InChIKey | FWBFDXIBOYYUPH-DBLYXWCISA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobacteriochlorin (CHEBI:52583) is a isobacteriochlorins (CHEBI:52582) |
| isobacteriochlorin (CHEBI:52583) is a tetrapyrrole fundamental parent (CHEBI:35794) |
| IUPAC Names |
|---|
| 2,3,7,8-tetrahydroporphyrin |
| isobacteriochlorin |
| Registry Numbers | Sources |
|---|---|
| Beilstein:320115 | Beilstein |
| Beilstein:1164153 | Beilstein |