EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H38N12 |
| Net Charge | 0 |
| Average Mass | 927.048 |
| Monoisotopic Mass | 926.33424 |
| SMILES | C1=Cc2cc3ccc(n3)c(-c3c4nc(cc5ccc(n5)c(-c5c6nc(cc7ccc(cc8nc(cc9ccc5n9)C=C8)n7)C=C6)c5nc(cc6ccc3n6)C=C5)C=C4)c3nc(cc4ccc(cc1n2)n4)C=C3 |
| InChI | InChI=1S/C60H38N12/c1-5-37-27-41-9-17-49(65-41)57(50-18-10-42(66-50)28-38-6-2-34(62-38)25-33(1)61-37)59-53-21-13-45(69-53)31-47-15-23-55(71-47)60(56-24-16-48(72-56)32-46-14-22-54(59)70-46)58-51-19-11-43(67-51)29-39-7-3-35(63-39)26-36-4-8-40(64-36)30-44-12-20-52(58)68-44/h1-32,61,63,66,68-69,72H/b33-25-,34-25-,35-26-,36-26-,37-27-,38-28-,39-29-,40-30-,41-27-,42-28-,43-29-,44-30-,45-31-,46-32-,47-31-,48-32-,57-49+,57-50+,58-51+,58-52+,59-53+,59-54+,60-55+,60-56+ |
| InChIKey | KFVJBQGBBZTRQL-FFRXQIMTSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5':15',5''-terporphyrin (CHEBI:52563) is a triporphyrin (CHEBI:52540) |
| IUPAC Name |
|---|
| 5,5':15',5''-terporphyrin |
| Synonyms | Source |
|---|---|
| 20,10',20',10''-triporphyrin | ChEBI |
| 5,5':15',5''-terporphine | ChEBI |