EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16N4 |
| Net Charge | 0 |
| Average Mass | 312.376 |
| Monoisotopic Mass | 312.13750 |
| SMILES | C1=C/C2=C/c3ccc(n3)Cc3ccc(n3)/C=c3/cc/c(n3)=C/C1=N2 |
| InChI | InChI=1S/C20H16N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-11,21,23-24H,12H2/b13-9-,14-10-,17-11- |
| InChIKey | IQDRAVRWQIIASA-VZPOTTSCSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phlorin (CHEBI:52560) is a isoporphyrin (CHEBI:52538) |
| IUPAC Name |
|---|
| 5,22-dihydroporphyrin |
| Registry Numbers | Sources |
|---|---|
| CAS:26660-92-4 | ChemIDplus |