EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O2 |
| Net Charge | 0 |
| Average Mass | 306.490 |
| Monoisotopic Mass | 306.25588 |
| SMILES | C/C1=C\[C@H](O)C[C@](C)(O)/C=C/[C@H](C(C)C)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H34O2/c1-15(2)18-10-9-16(3)7-6-8-17(4)13-19(21)14-20(5,22)12-11-18/h7,11-13,15,18-19,21-22H,6,8-10,14H2,1-5H3/b12-11+,16-7+,17-13+/t18-,19+,20-/m1/s1 |
| InChIKey | RIVKDDXPCFBMOV-PTDQARIVSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cembra-2,7,11-triene-4,6-diol (CHEBI:525464) has role antineoplastic agent (CHEBI:35610) |
| cembra-2,7,11-triene-4,6-diol (CHEBI:525464) is a cembrane diterpenoid (CHEBI:60687) |
| IUPAC Name |
|---|
| (1S,3R,4E,8E,12S,13E)-1,5,9-trimethyl-12-(propan-2-yl)cyclotetradeca-4,8,13-triene-1,3-diol |
| Synonyms | Source |
|---|---|
| 2,7,11-Cembratrien-4,6-diol | KEGG COMPOUND |
| (1S,2E,4S,6R,7E,11E)-2,7,11-cembratriene-4,6-diol | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:57605-80-8 | KEGG COMPOUND |
| CAS:57605-80-8 | ChemIDplus |
| Citations |
|---|