EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14N4O3 |
| Net Charge | 0 |
| Average Mass | 358.357 |
| Monoisotopic Mass | 358.10659 |
| SMILES | Oc1c2ccc(cc3nc(c(O)c4ccc(n4)c(O)c4nc1C=C4)C=C3)n2 |
| InChI | InChI=1S/C20H14N4O3/c25-18-12-3-1-10(21-12)9-11-2-4-13(22-11)19(26)15-6-8-17(24-15)20(27)16-7-5-14(18)23-16/h1-9,21,24-27H/b10-9-,11-9-,18-12+,18-14+,19-13+,19-15+,20-16+,20-17+ |
| InChIKey | CJAFHDHFNAMRLY-DZSIWSQBSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,10,15-trihydroxyporphyrin (CHEBI:52546) is a 5,10,15-trisubstituted porphyrin (CHEBI:52533) |
| IUPAC Name |
|---|
| porphyrin-5,10,15-triol |
| Synonym | Source |
|---|---|
| 5,10,15-trihydroxyporphine | ChEBI |