EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H26N8 |
| Net Charge | 0 |
| Average Mass | 618.704 |
| Monoisotopic Mass | 618.22804 |
| SMILES | C1=Cc2cc3ccc(n3)c(-c3c4nc(cc5ccc(cc6nc(cc7ccc3n7)C=C6)n5)C=C4)c3nc(cc4ccc(cc1n2)n4)C=C3 |
| InChI | InChI=1S/C40H26N8/c1-5-27-19-31-9-13-35(45-31)39(36-14-10-32(46-36)20-28-6-2-24(42-28)17-23(1)41-27)40-37-15-11-33(47-37)21-29-7-3-25(43-29)18-26-4-8-30(44-26)22-34-12-16-38(40)48-34/h1-22,41,43,46,48H/b23-17-,24-17-,25-18-,26-18-,27-19-,28-20-,29-21-,30-22-,31-19-,32-20-,33-21-,34-22-,39-35+,39-36+,40-37+,40-38+ |
| InChIKey | WFNAZWVAQCIMFH-NNOJRWIMSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5'-biporphyrin (CHEBI:52545) is a meso-meso-diporphyrin (CHEBI:52532) |
| IUPAC Name |
|---|
| 5,5'-biporphyrin |
| Synonyms | Source |
|---|---|
| 10,20'-biporphine | ChEBI |
| 10,20'-biporphyrin | ChEBI |