EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H26N8 |
| Net Charge | 0 |
| Average Mass | 618.704 |
| Monoisotopic Mass | 618.22804 |
| SMILES | C1=Cc2cc3cc(-c4c5ccc(cc6nc(cc7ccc(cc8nc4C=C8)n7)C=C6)n5)c(cc4nc(cc5ccc(cc1n2)n5)C=C4)n3 |
| InChI | InChI=1S/C40H26N8/c1-2-26-17-28-9-10-34(45-28)22-39-36(21-35(48-39)20-31-8-7-27(44-31)16-23(1)41-26)40-37-13-11-32(46-37)18-29-5-3-24(42-29)15-25-4-6-30(43-25)19-33-12-14-38(40)47-33/h1-22,41-42,47-48H/b23-16-,24-15-,25-15-,26-17-,27-16-,28-17-,29-18-,30-19-,31-20-,32-18-,33-19-,34-22-,35-20-,39-22-,40-37-,40-38- |
| InChIKey | FVWKJVIYUMMXQX-ITSBINMUSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5'-biporphyrin (CHEBI:52544) is a diporphyrin (CHEBI:52212) |
| IUPAC Name |
|---|
| 2,5'-biporphyrin |
| Synonyms | Source |
|---|---|
| 2,20'-biporphine | ChEBI |
| 2,20'-biporphyrin | ChEBI |
| 2,5'-biporphine | ChEBI |