EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O2 |
| Net Charge | 0 |
| Average Mass | 218.256 |
| Monoisotopic Mass | 218.10553 |
| SMILES | Cc1ccc2ncc(CC(N)C(=O)O)c2c1 |
| InChI | InChI=1S/C12H14N2O2/c1-7-2-3-11-9(4-7)8(6-14-11)5-10(13)12(15)16/h2-4,6,10,14H,5,13H2,1H3,(H,15,16) |
| InChIKey | HUNCSWANZMJLPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyltryptophan (CHEBI:52524) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 5-methyltryptophan (CHEBI:52524) is a tryptophan derivative (CHEBI:27164) |
| Incoming Relation(s) |
| 5-methyl-D-tryptophan (CHEBI:52525) is a 5-methyltryptophan (CHEBI:52524) |
| 5-methyl-DL-tryptophan (CHEBI:52446) is a 5-methyltryptophan (CHEBI:52524) |
| 5-methyl-L-tryptophan (CHEBI:52527) is a 5-methyltryptophan (CHEBI:52524) |