EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O9 |
| Net Charge | 0 |
| Average Mass | 406.387 |
| Monoisotopic Mass | 406.12638 |
| SMILES | [H][C@@]1([C@H](OC)C(=O)[C@@H](O)[C@@H](C)O)Cc2cc3cc(O)cc(O)c3c(O)c2C(=O)[C@H]1O |
| InChI | InChI=1S/C20H22O9/c1-7(21)15(24)19(28)20(29-2)11-5-9-3-8-4-10(22)6-12(23)13(8)17(26)14(9)18(27)16(11)25/h3-4,6-7,11,15-16,20-26H,5H2,1-2H3/t7-,11-,15+,16+,20+/m1/s1 |
| InChIKey | PIHTXGRVQBTVRE-KFYAXVMHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olivin (CHEBI:52512) has role metabolite (CHEBI:25212) |
| olivin (CHEBI:52512) is a anthracenone (CHEBI:146281) |
| olivin (CHEBI:52512) is a decaketide (CHEBI:48128) |
| olivin (CHEBI:52512) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (1S)-5-deoxy-1-O-methyl-1-C-[(2R,3S)-3,5,7,10-tetrahydroxy-4-oxo-1,2,3,4-tetrahydroanthracen-2-yl]-D-xylulose |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2067481 | Beilstein |
| CAS:6680-06-4 | ChemIDplus |