EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H16N4O2 |
| Net Charge | 0 |
| Average Mass | 188.231 |
| Monoisotopic Mass | 188.12733 |
| SMILES | C[C@@H](CC[C@H](N)C(=O)O)NC(=N)N |
| InChI | InChI=1S/C7H16N4O2/c1-4(11-7(9)10)2-3-5(8)6(12)13/h4-5H,2-3,8H2,1H3,(H,12,13)(H4,9,10,11)/t4-,5-/m0/s1 |
| InChIKey | AATIXZODJZMQQA-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5S)-5-methyl-L-arginine (CHEBI:52504) is a 5-methyl-L-arginine (CHEBI:20604) |
| (5S)-5-methyl-L-arginine (CHEBI:52504) is conjugate base of amino{[(2S,5S)-5-amino-5-carboxypentan-2-yl]amino}methaniminium (CHEBI:40617) |
| Incoming Relation(s) |
| amino{[(2S,5S)-5-amino-5-carboxypentan-2-yl]amino}methaniminium (CHEBI:40617) is conjugate acid of (5S)-5-methyl-L-arginine (CHEBI:52504) |
| IUPAC Name |
|---|
| (5S)-5-carbamimidamido-L-norleucine |
| Synonym | Source |
|---|---|
| (2S,5S)-2-amino-5-carbamimidamidohexanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11366626 | Beilstein |