EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C(=O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21)17-15-18-20(22)23/h6-7,9-10,12-14,16H,2-5,8,11,15,17-18H2,1H3,(H,22,23)/b7-6-,10-9-,13-12-,16-14+ |
| InChIKey | MEASLHGILYBXFO-XTDASVJISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (8906847) | |
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-oxo-ETE (CHEBI:52449) has functional parent icosa-6,8,11,14-tetraenoic acid (CHEBI:36040) |
| 5-oxo-ETE (CHEBI:52449) has role human metabolite (CHEBI:77746) |
| 5-oxo-ETE (CHEBI:52449) has role immunomodulator (CHEBI:50846) |
| 5-oxo-ETE (CHEBI:52449) has role mouse metabolite (CHEBI:75771) |
| 5-oxo-ETE (CHEBI:52449) is a oxoicosatetraenoic acid (CHEBI:61704) |
| 5-oxo-ETE (CHEBI:52449) is conjugate acid of 5-oxo-ETE(1−) (CHEBI:65342) |
| Incoming Relation(s) |
| 5-oxo-ETE(1−) (CHEBI:65342) is conjugate base of 5-oxo-ETE (CHEBI:52449) |
| IUPAC Name |
|---|
| (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 5-KETE | ChEBI |
| 5-ketoeicosatetraenoic acid | ChEBI |
| 5-keto-ETE | ChEBI |
| 5-oxo, 6t,8c,11c,14c-20:4 | ChEBI |
| 5-oxo-6E,8Z,11Z,14Z-eicosatetraenoic acid | SUBMITTER |
| 5-oxo-6(E),8(Z),11(Z),14(Z)-eicosatetraenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14732 | KEGG COMPOUND |
| HMDB0010217 | HMDB |
| LMFA03060011 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6213921 | Reaxys |
| Citations |
|---|