EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N5O3 |
| Net Charge | 0 |
| Average Mass | 241.251 |
| Monoisotopic Mass | 241.11749 |
| SMILES | C[C@@H](O)[C@H](O)C1CNc2nc(N)nc(=O)c2N1 |
| InChI | InChI=1S/C9H15N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3-4,6,12,15-16H,2H2,1H3,(H4,10,11,13,14,17)/t3-,4?,6+/m1/s1 |
| InChIKey | FNKQXYHWGSIFBK-UNEIAVTISA-N |
| Roles Classification |
|---|
| Biological Roles: | prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydrodictyopterin (CHEBI:52447) has role prosthetic group (CHEBI:26348) |
| tetrahydrodictyopterin (CHEBI:52447) is a 5,6,7,8-tetrahydrobiopterin (CHEBI:15372) |
| IUPAC Name |
|---|
| 2-amino-6-[(1R,2R)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydropteridin-4(3H)-one |
| Synonyms | Source |
|---|---|
| DH4 | SUBMITTER |
| D-threo-tetrahydrobiopterin | SUBMITTER |