EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O7S2 |
| Net Charge | -2 |
| Average Mass | 412.445 |
| Monoisotopic Mass | 412.04099 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)C(c1ccccc1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C16H18N2O7S2/c1-16(2)11(15(21)22)18-13(20)9(14(18)26-16)17-12(19)10(27(23,24)25)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,17,19)(H,21,22)(H,23,24,25)/p-2/t9-,10?,11+,14-/m1/s1 |
| InChIKey | JETQIUPBHQNHNZ-OAYJICASSA-L |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulbenicillin(2−) (CHEBI:52436) is a penicillinate anion (CHEBI:51356) |
| sulbenicillin(2−) (CHEBI:52436) is conjugate base of sulbenicillin (CHEBI:9322) |
| Incoming Relation(s) |
| sulbenicillin disodium (CHEBI:32160) has part sulbenicillin(2−) (CHEBI:52436) |
| sulbenicillin (CHEBI:9322) is conjugate acid of sulbenicillin(2−) (CHEBI:52436) |
| IUPAC Name |
|---|
| 6β-[phenyl(sulfonato)acetamido]-2,2-dimethylpenam-3α-carboxylate |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-3,3-dimethyl-7-oxo-6-{[phenyl(sulfo)acetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5396701 | Beilstein |