EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N2O5S |
| Net Charge | -1 |
| Average Mass | 377.442 |
| Monoisotopic Mass | 377.11767 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)C(CC)Oc1ccccc1 |
| InChI | InChI=1S/C18H22N2O5S/c1-4-11(25-10-8-6-5-7-9-10)14(21)19-12-15(22)20-13(17(23)24)18(2,3)26-16(12)20/h5-9,11-13,16H,4H2,1-3H3,(H,19,21)(H,23,24)/p-1/t11?,12-,13+,16-/m1/s1 |
| InChIKey | HOCWPKXKMNXINF-XQERAMJGSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propicillin(1−) (CHEBI:52435) is a penicillinate anion (CHEBI:51356) |
| propicillin(1−) (CHEBI:52435) is conjugate base of propicillin (CHEBI:52429) |
| Incoming Relation(s) |
| propicillin potassium (CHEBI:32062) has part propicillin(1−) (CHEBI:52435) |
| propicillin (CHEBI:52429) is conjugate acid of propicillin(1−) (CHEBI:52435) |
| IUPAC Name |
|---|
| 6β-(2-phenoxybutanamido)-2,2-dimethylpenam-3α-carboxylate |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenoxybutanoyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5405732 | Beilstein |