EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO5 |
| Net Charge | 0 |
| Average Mass | 223.184 |
| Monoisotopic Mass | 223.04807 |
| SMILES | O=C(O)CC(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C10H9NO5/c12-8(5-9(13)14)11-7-4-2-1-3-6(7)10(15)16/h1-4H,5H2,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | ZDSSCYCDBASEJQ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-malonylanthranilic acid (CHEBI:52430) has functional parent anthranilic acid (CHEBI:30754) |
| N-malonylanthranilic acid (CHEBI:52430) is a dicarboxylic acid monoamide (CHEBI:35735) |
| N-malonylanthranilic acid (CHEBI:52430) is conjugate acid of N-malonylanthranilate (CHEBI:16872) |
| Incoming Relation(s) |
| N-malonylanthranilate (CHEBI:16872) is conjugate base of N-malonylanthranilic acid (CHEBI:52430) |
| IUPAC Name |
|---|
| 2-[(carboxyacetyl)amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| C03147 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2852839 | Beilstein |