EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N2O5S |
| Net Charge | -1 |
| Average Mass | 363.415 |
| Monoisotopic Mass | 363.10202 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)C(C)Oc1ccccc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-9(24-10-7-5-4-6-8-10)13(20)18-11-14(21)19-12(16(22)23)17(2,3)25-15(11)19/h4-9,11-12,15H,1-3H3,(H,18,20)(H,22,23)/p-1/t9?,11-,12+,15-/m1/s1 |
| InChIKey | NONJJLVGHLVQQM-JHXYUMNGSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenethicillin(1−) (CHEBI:52428) is a penicillinate anion (CHEBI:51356) |
| phenethicillin(1−) (CHEBI:52428) is conjugate base of phenethicillin (CHEBI:52427) |
| Incoming Relation(s) |
| phenethicillin potassium (CHEBI:31987) has part phenethicillin(1−) (CHEBI:52428) |
| phenethicillin (CHEBI:52427) is conjugate acid of phenethicillin(1−) (CHEBI:52428) |
| IUPAC Name |
|---|
| 6β-(2-phenoxypropanamido)-2,2-dimethylpenam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenoxypropanoyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| pheneticillin(1−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5405596 | Beilstein |