EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H46O3 |
| Net Charge | 0 |
| Average Mass | 382.629 |
| Monoisotopic Mass | 382.34470 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C24H46O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(25)22-24(26)27/h2-22H2,1H3,(H,26,27) |
| InChIKey | LTCWTQLFMAJHBA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxotetracosanoic acid (CHEBI:52352) has functional parent tetracosanoic acid (CHEBI:28866) |
| 3-oxotetracosanoic acid (CHEBI:52352) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| Incoming Relation(s) |
| 3-oxotetracosanoyl-CoA (CHEBI:52329) has functional parent 3-oxotetracosanoic acid (CHEBI:52352) |
| IUPAC Name |
|---|
| 3-oxotetracosanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060147 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1801531 | Beilstein |