EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H42O3 |
| Net Charge | 0 |
| Average Mass | 354.575 |
| Monoisotopic Mass | 354.31340 |
| SMILES | CCCCCCCCCCCCCCCCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C22H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20-22(24)25/h2-20H2,1H3,(H,24,25) |
| InChIKey | GLJSCOCOXZOMDN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxodocosanoic acid (CHEBI:52351) has functional parent docosanoic acid (CHEBI:28941) |
| 3-oxodocosanoic acid (CHEBI:52351) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| Incoming Relation(s) |
| 3-oxodocosanoyl-CoA (CHEBI:52328) has functional parent 3-oxodocosanoic acid (CHEBI:52351) |
| IUPAC Name |
|---|
| 3-oxodocosanoic acid |
| Synonym | Source |
|---|---|
| 3-oxobehenic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060142 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1799737 | Beilstein |