EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O3 |
| Net Charge | 0 |
| Average Mass | 326.521 |
| Monoisotopic Mass | 326.28210 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C20H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(21)18-20(22)23/h2-18H2,1H3,(H,22,23) |
| InChIKey | MZPZMTFDSVTILM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxoicosanoic acid (CHEBI:52350) has functional parent icosanoic acid (CHEBI:28822) |
| 3-oxoicosanoic acid (CHEBI:52350) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| 3-oxoicosanoic acid (CHEBI:52350) is a long-chain fatty acid (CHEBI:15904) |
| Incoming Relation(s) |
| 3-oxoicosanoyl-CoA (CHEBI:52327) has functional parent 3-oxoicosanoic acid (CHEBI:52350) |
| IUPAC Name |
|---|
| 3-oxoicosanoic acid |
| Synonyms | Source |
|---|---|
| 3-oxoeicosanoic acid | ChEBI |
| 3-oxoarachidic acid | ChEBI |
| β-oxoeicosanoic acid | ChEBI |
| β-oxoicosanoic acid | ChEBI |
| β-oxoarachidic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060134 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1796542 | Beilstein |