EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H48O3 |
| Net Charge | 0 |
| Average Mass | 384.645 |
| Monoisotopic Mass | 384.36035 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(O)CC(=O)O |
| InChI | InChI=1S/C24H48O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(25)22-24(26)27/h23,25H,2-22H2,1H3,(H,26,27) |
| InChIKey | DVDLWGAAEYKXSB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxytetracosanoic acid (CHEBI:52349) has functional parent tetracosanoic acid (CHEBI:28866) |
| 3-hydroxytetracosanoic acid (CHEBI:52349) is a 3-hydroxy fatty acid (CHEBI:59845) |
| Incoming Relation(s) |
| 3-hydroxytetracosanoyl-CoA (CHEBI:52326) has functional parent 3-hydroxytetracosanoic acid (CHEBI:52349) |
| IUPAC Name |
|---|
| 3-hydroxytetracosanoic acid |
| Synonym | Source |
|---|---|
| 3-hydroxylignoceric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050214 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1800967 | Reaxys |