EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H44O3 |
| Net Charge | 0 |
| Average Mass | 356.591 |
| Monoisotopic Mass | 356.32905 |
| SMILES | CCCCCCCCCCCCCCCCCCCC(O)CC(=O)O |
| InChI | InChI=1S/C22H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20-22(24)25/h21,23H,2-20H2,1H3,(H,24,25) |
| InChIKey | PNPWTPYWWUOMDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxydocosanoic acid (CHEBI:52348) has functional parent docosanoic acid (CHEBI:28941) |
| 3-hydroxydocosanoic acid (CHEBI:52348) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| Incoming Relation(s) |
| 3-hydroxydocosanoyl-CoA (CHEBI:52325) has functional parent 3-hydroxydocosanoic acid (CHEBI:52348) |
| IUPAC Name |
|---|
| 3-hydroxydocosanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050078 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1797971 | Beilstein |