EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O3 |
| Net Charge | 0 |
| Average Mass | 328.537 |
| Monoisotopic Mass | 328.29775 |
| SMILES | CCCCCCCCCCCCCCCCCC(O)CC(=O)O |
| InChI | InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(21)18-20(22)23/h19,21H,2-18H2,1H3,(H,22,23) |
| InChIKey | XXKHCFPQYSMGCI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyicosanoic acid (CHEBI:52347) has functional parent icosanoic acid (CHEBI:28822) |
| 3-hydroxyicosanoic acid (CHEBI:52347) has role metabolite (CHEBI:25212) |
| 3-hydroxyicosanoic acid (CHEBI:52347) is a 3-hydroxy fatty acid (CHEBI:59845) |
| 3-hydroxyicosanoic acid (CHEBI:52347) is a long-chain fatty acid (CHEBI:15904) |
| 3-hydroxyicosanoic acid (CHEBI:52347) is conjugate acid of 3-hydroxyicosanoate (CHEBI:76709) |
| Incoming Relation(s) |
| 3-hydroxyicosanoyl-CoA (CHEBI:52324) has functional parent 3-hydroxyicosanoic acid (CHEBI:52347) |
| 3-hydroxyicosanoate (CHEBI:76709) is conjugate base of 3-hydroxyicosanoic acid (CHEBI:52347) |
| IUPAC Name |
|---|
| 3-hydroxyicosanoic acid |
| Synonyms | Source |
|---|---|
| 3-hydroxyarachidic acid | ChEBI |
| 3-hydroxyeicosanoic acid | ChEBI |
| β-hydroxyachidic acid | ChEBI |
| β-hydroxyeicosanoic acid | ChEBI |
| β-hydroxyicosanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050074 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1794299 | Reaxys |
| Citations |
|---|