EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31N2O3.Cl |
| Net Charge | 0 |
| Average Mass | 479.020 |
| Monoisotopic Mass | 478.20232 |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3C(=O)O)c3ccc(=[N+](CC)CC)cc-3oc2c1.[Cl-] |
| InChI | InChI=1S/C28H30N2O3.ClH/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32;/h9-18H,5-8H2,1-4H3;1H |
| InChIKey | PYWVYCXTNDRMGF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhodamine B (CHEBI:52334) has part rhodamine B(1+) (CHEBI:52896) |
| rhodamine B (CHEBI:52334) has role fluorescent probe (CHEBI:39442) |
| rhodamine B (CHEBI:52334) has role fluorochrome (CHEBI:51217) |
| rhodamine B (CHEBI:52334) has role histological dye (CHEBI:77178) |
| rhodamine B (CHEBI:52334) is a organic chloride salt (CHEBI:36094) |
| rhodamine B (CHEBI:52334) is a xanthene dye (CHEBI:37929) |
| IUPAC Name |
|---|
| N-[9-(2-carboxyphenyl)-6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethylethanaminium chloride |
| Synonyms | Source |
|---|---|
| Acid Brilliant Pink B | ChemIDplus |
| Basic Rose Extract | ChemIDplus |
| Basic Rose Red | ChemIDplus |
| Basic Violet 10 | ChemIDplus |
| Basonyl Red 545 | ChemIDplus |
| Brilliant Pink B | ChemIDplus |
| Citations |
|---|