EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10N3S.Cl |
| Net Charge | 0 |
| Average Mass | 263.753 |
| Monoisotopic Mass | 263.02840 |
| SMILES | Nc1ccc2nc3ccc(N)cc3[s+]c2c1.[Cl-] |
| InChI | InChI=1S/C12H10N3S.ClH/c13-7-1-3-9-11(5-7)16-12-6-8(14)2-4-10(12)15-9;/h1-6H,13-14H2;1H/q+1;/p-1 |
| InChIKey | ANRHNWWPFJCPAZ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thionine (CHEBI:52295) has part thionine cation (CHEBI:52926) |
| thionine (CHEBI:52295) has role fluorochrome (CHEBI:51217) |
| thionine (CHEBI:52295) has role histological dye (CHEBI:77178) |
| thionine (CHEBI:52295) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 3,7-diaminophenothiazin-5-ium chloride |
| Synonyms | Source |
|---|---|
| C.I. 52000 | ChEBI |
| Cyanine | ChemIDplus |
| Katalysin | ChemIDplus |
| Lauthsches violett | ChemIDplus |
| Lauth's Violet | ChemIDplus |
| Thionin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3921370 | Reaxys |
| CAS:581-64-6 | ChemIDplus |