EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N2S.C7H7O3S |
| Net Charge | 0 |
| Average Mass | 476.623 |
| Monoisotopic Mass | 476.12283 |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.[H]C(=C1Sc2ccccc2N1C)c1cc[n+](C)c2ccccc12 |
| InChI | InChI=1S/C19H17N2S.C7H8O3S/c1-20-12-11-14(15-7-3-4-8-16(15)20)13-19-21(2)17-9-5-6-10-18(17)22-19;1-6-2-4-7(5-3-6)11(8,9)10/h3-13H,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | ACOJCCLIDPZYJC-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiazole orange (CHEBI:52293) has part thiazole orange cation (CHEBI:52924) |
| thiazole orange (CHEBI:52293) has role fluorochrome (CHEBI:51217) |
| thiazole orange (CHEBI:52293) is a cyanine dye (CHEBI:37960) |
| IUPAC Names |
|---|
| 1-methyl-4-[(3-methyl-1,3-benzothiazol-2(3H)-ylidene)methyl]quinolinium 4-methylbenzenesulfonate |
| 3-methyl-2-[(1-methylquinolin-4(1H)-ylidene)methyl]-1,3-benzothiazol-3-ium 4-methylbenzenesulfonate |
| Synonyms | Source |
|---|---|
| 1-methyl-4-[(3-methyl-2(3H)-benzothiazolylidene)methyl]quinolinium p-tosylate | ChEBI |
| 1-methyl-4-((3-methyl-2(3H)-benzothiazolylidene)methyl)quinolinium, salt with 4-methylbenzenesulfonic acid (1:1) | ChemIDplus |
| TO1-2p | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11376685 | Beilstein |
| Reaxys:15037459 | Reaxys |
| CAS:107091-89-4 | ChemIDplus |
| Citations |
|---|