EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H30N4 |
| Net Charge | 0 |
| Average Mass | 614.752 |
| Monoisotopic Mass | 614.24705 |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc(n1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc(n3)c2-c2ccccc2)C=C1 |
| InChI | InChI=1S/C44H30N4/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36/h1-28,45,48H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | YNHJECZULSZAQK-LWQDQPMZSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetraphenylporphyrin (CHEBI:52279) is a meso-substituted porphyrin (CHEBI:52188) |
| tetraphenylporphyrin (CHEBI:52279) is a phenylporphyrin (CHEBI:52539) |
| IUPAC Name |
|---|
| 5,10,15,20-tetraphenylporphyrin |
| Synonyms | Source |
|---|---|
| meso-Tetraphenylporphine | ChemIDplus |
| TPP | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:379542 | Beilstein |
| CAS:917-23-7 | ChemIDplus |