EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H54N4 |
| Net Charge | 0 |
| Average Mass | 783.076 |
| Monoisotopic Mass | 782.43485 |
| SMILES | Cc1cc(C)c(-c2c3ccc(n3)c(-c3c(C)cc(C)cc3C)c3nc(c(-c4c(C)cc(C)cc4C)c4ccc(n4)c(-c4c(C)cc(C)cc4C)c4nc2C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C56H54N4/c1-29-21-33(5)49(34(6)22-29)53-41-13-15-43(57-41)54(50-35(7)23-30(2)24-36(50)8)45-17-19-47(59-45)56(52-39(11)27-32(4)28-40(52)12)48-20-18-46(60-48)55(44-16-14-42(53)58-44)51-37(9)25-31(3)26-38(51)10/h13-28,57,60H,1-12H3/b53-41+,53-42+,54-43+,54-45+,55-44+,55-46+,56-47+,56-48+ |
| InChIKey | KBIOUJDBIXSYJT-RNWYWIMESA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetramesitylporphyrin (CHEBI:52278) is a meso-substituted porphyrin (CHEBI:52188) |
| IUPAC Name |
|---|
| 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)porphyrin |
| Synonyms | Source |
|---|---|
| 5,10,15,20-tetrakis(2,4,6-trimethylphenyl)-21H,23H-porphine | ChEBI |
| meso-tetra(2,4,6-trimethylphenyl)porphyrin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:603519 | Beilstein |