EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O2 |
| Net Charge | 0 |
| Average Mass | 320.392 |
| Monoisotopic Mass | 320.15248 |
| SMILES | CN(C)c1ccc(C2=C([O-])C(=C3C=CC(=[N+](C)C)C=C3)C2=O)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-21(2)15-9-5-13(6-10-15)17-19(23)18(20(17)24)14-7-11-16(12-8-14)22(3)4/h5-12H,1-4H3 |
| InChIKey | HERJDZWHZQOZLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. squaraine dye An organic dye characterized by an aromatic four-membered ring system derived from squaric acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| squarylium dye III (CHEBI:52272) has role fluorochrome (CHEBI:51217) |
| squarylium dye III (CHEBI:52272) has role squaraine dye (CHEBI:52271) |
| squarylium dye III (CHEBI:52272) is a dimethylaniline (CHEBI:23806) |
| squarylium dye III (CHEBI:52272) is a squaraine (CHEBI:59717) |
| IUPAC Name |
|---|
| 2-[4-(dimethylamino)phenyl]-4-[4-(dimethyliminio)cyclohexa-2,5-dien-1-ylidene]-3-oxocyclobut-1-en-1-olate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3628357 | Beilstein |