EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H42N2O15 |
| Net Charge | 0 |
| Average Mass | 838.819 |
| Monoisotopic Mass | 838.25852 |
| SMILES | COc1cc2cc(-c3ccc(C(=O)O)cc3C(=O)O)oc2cc1N1CCOCCOCCN(c2cc3oc(-c4ccc(C(=O)O)cc4C(=O)O)cc3cc2OC)CCOCC1 |
| InChI | InChI=1S/C44H42N2O15/c1-55-39-21-27-19-37(29-5-3-25(41(47)48)17-31(29)43(51)52)60-35(27)23-33(39)45-7-11-57-12-8-46(10-14-59-16-15-58-13-9-45)34-24-36-28(22-40(34)56-2)20-38(61-36)30-6-4-26(42(49)50)18-32(30)44(53)54/h3-6,17-24H,7-16H2,1-2H3,(H,47,48)(H,49,50)(H,51,52)(H,53,54) |
| InChIKey | UGJCNRLBGKEGEH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium-binding benzofuran isophthalate (CHEBI:52262) has role fluorochrome (CHEBI:51217) |
| sodium-binding benzofuran isophthalate (CHEBI:52262) is a 1-benzofurans (CHEBI:38830) |
| sodium-binding benzofuran isophthalate (CHEBI:52262) is a aromatic ether (CHEBI:35618) |
| sodium-binding benzofuran isophthalate (CHEBI:52262) is a crown compound (CHEBI:37409) |
| sodium-binding benzofuran isophthalate (CHEBI:52262) is a tetracarboxylic acid (CHEBI:35742) |
| IUPAC Name |
|---|
| 4,4'-{1,4,10-trioxa-7,13-diazacyclopentadecane-7,13-diylbis[5-(methyloxy)-1-benzofuran-6,2-diyl]}dibenzene-1,3-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| 4,4'-[1,4,10-trioxa-7,13-diazacyclopentadecane-7,13-diylbis(5-methoxy-1-benzofuran-6,2-diyl)]diisophthalic acid | ChEBI |
| SBFI | ChemIDplus |
| Sodium benzofuran isophthalate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 110415 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:124549-08-2 | ChemIDplus |
| Citations |
|---|