EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H2Cl4I4O5.2K |
| Net Charge | 0 |
| Average Mass | 1049.855 |
| Monoisotopic Mass | 1047.41094 |
| SMILES | O=C([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1-c1c2cc(I)c(=O)c(I)c-2oc2c(I)c([O-])c(I)cc12.[K+].[K+] |
| InChI | InChI=1S/C20H4Cl4I4O5.2K/c21-10-8(9(20(31)32)11(22)13(24)12(10)23)7-3-1-5(25)16(29)14(27)18(3)33-19-4(7)2-6(26)17(30)15(19)28;;/h1-2,29H,(H,31,32);;/q;2*+1/p-2 |
| InChIKey | AZJPTIGZZTZIDR-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rose bengal (CHEBI:52261) has functional parent fluorescin (CHEBI:42492) |
| rose bengal (CHEBI:52261) has part rose bengal(2−) (CHEBI:52904) |
| rose bengal (CHEBI:52261) has role fluorochrome (CHEBI:51217) |
| rose bengal (CHEBI:52261) has role histological dye (CHEBI:77178) |
| rose bengal (CHEBI:52261) is a organic potassium salt (CHEBI:50394) |
| rose bengal (CHEBI:52261) is a xanthene dye (CHEBI:37929) |
| IUPAC Name |
|---|
| dipotassium 2,3,4,5-tetrachloro-6-(2,4,5,7-tetraiodo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate |
| Synonyms | Source |
|---|---|
| Rose bengale | ChemIDplus |
| Bengal rose | ChemIDplus |
| Red No. 105 | ChemIDplus |
| Acid red 94 | ChEBI |
| C.I. 45440 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4121962 | Reaxys |
| CAS:11121-48-5 | ChemIDplus |
| Citations |
|---|