EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H8F20N4Pt |
| Net Charge | 0 |
| Average Mass | 1167.614 |
| Monoisotopic Mass | 1167.00775 |
| SMILES | Fc1c(F)c(F)c(C2=C3C=CC4=[N]3[Pt]35[N]6=C(C=CC6=C(c6c(F)c(F)c(F)c(F)c6F)c6ccc2[n]63)C(c2c(F)c(F)c(F)c(F)c2F)=c2ccc([n]25)=C4c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C44H8F20N4.Pt/c45-25-21(26(46)34(54)41(61)33(25)53)17-9-1-2-10(65-9)18(22-27(47)35(55)42(62)36(56)28(22)48)12-5-6-14(67-12)20(24-31(51)39(59)44(64)40(60)32(24)52)16-8-7-15(68-16)19(13-4-3-11(17)66-13)23-29(49)37(57)43(63)38(58)30(23)50;/h1-8H;/q-2;+2/b17-9+,17-11+,18-10+,18-12+,19-13+,19-15+,20-14+,20-16+; |
| InChIKey | OXKPMKLTIJUTAM-HQJDZOCDSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| platinum(II) 5,10,15,20-tetrakis-(2,3,4,5,6-pentafluorophenyl)porphyrin (CHEBI:52247) has role fluorochrome (CHEBI:51217) |
| platinum(II) 5,10,15,20-tetrakis-(2,3,4,5,6-pentafluorophenyl)porphyrin (CHEBI:52247) is a platinum porphyrin (CHEBI:52244) |
| IUPAC Name |
|---|
| [5,10,15,20-tetrakis(pentafluorophenyl)porphyrinato-κ4N21,N22,N23,N24]platinum(II) |
| Synonyms | Source |
|---|---|
| Platinum(II)-5,10,15,20-tetrakis-(2,3,4,5,6-pentafluorophenyl)-porphyrin | ChEBI |
| PtTFPP | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11598927 | Beilstein |