EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@@]13CC[C@](C)(O)[C@H](C3)C2(C)C |
| InChI | InChI=1S/C15H26O/c1-10-5-6-11-13(2,3)12-9-15(10,11)8-7-14(12,4)16/h10-12,16H,5-9H2,1-4H3/t10-,11+,12-,14+,15+/m1/s1 |
| InChIKey | SVURIXNDRWRAFU-MIBAYGRRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epi-cedrol (CHEBI:52226) has role plant metabolite (CHEBI:76924) |
| epi-cedrol (CHEBI:52226) is a cedrane sesquiterpenoid (CHEBI:36745) |
| epi-cedrol (CHEBI:52226) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| cedran-8-ol |
| Synonyms | Source |
|---|---|
| 8-epicedrol | SUBMITTER |
| (3R,3aS,6S,7R,8aS)-3,6,8,8-tetramethyloctahydro-1H-3a,7-methanoazulen-6-ol | IUPAC |
| (−)-epicedrol | ChEBI |
| 8-epi-cedrol | NIST Chemistry WebBook |
| 8-epicedrol | ChEBI |
| UniProt Name | Source |
|---|---|
| epi-cedrol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3195903 | Reaxys |
| CAS:19903-73-2 | NIST Chemistry WebBook |
| Citations |
|---|