EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H44N4OPd |
| Net Charge | 0 |
| Average Mass | 655.195 |
| Monoisotopic Mass | 654.25500 |
| SMILES | CCC1=C(CC)C2=[N]3C1=Cc1c(CC)c(CC)c4[n]1[Pd]31[N]3=C(C=c5c(CC)c(CC)c([n]51)=C2)C(=O)C(CC)(CC)C3=C4 |
| InChI | InChI=1S/C36H45N4O.Pd/c1-9-21-22(10-2)28-18-30-25(13-5)26(14-6)32(39-30)20-34-36(15-7,16-8)35(41)33(40-34)19-31-24(12-4)23(11-3)29(38-31)17-27(21)37-28;/h17-20H,9-16H2,1-8H3,(H-,37,38,39,40,41);/q-1;+2/p-1 |
| InChIKey | DPIOVSWGZKCUKE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palladium(II) octaethylporphyrinketone (CHEBI:52199) has role fluorochrome (CHEBI:51217) |
| palladium(II) octaethylporphyrinketone (CHEBI:52199) is a palladium porphyrin (CHEBI:52200) |
| IUPAC Name |
|---|
| (3,3,7,8,12,13,17,18-octaethylporphyrin-2(3H)-one-κ4N21,N22,N23,N24)palladium |
| Synonym | Source |
|---|---|
| PdOEPK | ChEBI |