EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N2O2 |
| Net Charge | 0 |
| Average Mass | 318.376 |
| Monoisotopic Mass | 318.13683 |
| SMILES | CCN(CC)c1ccc2nc3c4ccccc4c(=O)cc-3oc2c1 |
| InChI | InChI=1S/C20H18N2O2/c1-3-22(4-2)13-9-10-16-18(11-13)24-19-12-17(23)14-7-5-6-8-15(14)20(19)21-16/h5-12H,3-4H2,1-2H3 |
| InChIKey | VOFUROIFQGPCGE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nile red (CHEBI:52169) has role fluorochrome (CHEBI:51217) |
| nile red (CHEBI:52169) has role histological dye (CHEBI:77178) |
| nile red (CHEBI:52169) is a aromatic amine (CHEBI:33860) |
| nile red (CHEBI:52169) is a cyclic ketone (CHEBI:3992) |
| nile red (CHEBI:52169) is a organic heterotetracyclic compound (CHEBI:38163) |
| nile red (CHEBI:52169) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 9-(diethylamino)-5H-benzo[a]phenoxazin-5-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:279110 | Reaxys |
| CAS:7385-67-3 | ChemIDplus |
| Citations |
|---|